Labetalol

Izvor: Wikipedija
(Preusmjereno sa stranice SGUAFYQXFOLMHL-UHFFFAOYSA-N)
Prijeđi na navigaciju Prijeđi na pretragu
Labetalol
(IUPAC) ime
(RS)-2-hidroksi-51-hidroksi-2-[(1-metil-3-fenolpropil)amino]etil
Klinički podaci
Identifikatori
ATC kod ?
Hemijski podaci
Formula ?
Farmakoinformacioni podaci
Trudnoća ?
Pravni status

benzamid

| image = (+-)-Labetalol Structural Formula V1.svg | width = 250 | image2 = | width2 = | imagename = 1 : 1 racemska smeša | drug_name = Labetalol

| tradename = Trandat | Drugs.com = Monografija | MedlinePlus = a685034 | pregnancy_category = C | legal_status = Rx-only | routes_of_administration = oralno iv

| bioavailability = 25% | protein_bound = 50% | metabolism = hepatički | elimination_half-life = Tableta: 6-8 sati; IV: 5.5 sati | excretion = urin

| CASNo_Ref =  DaY | CAS_number_Ref =  DaY | CAS_number = 36894-69-6 | ATC_prefix = C07 | ATC_suffix = AG01 | PubChem = 3869 | IUPHAR_ligand = | DrugBank_Ref = Šablon:Drugbankcite

| DrugBank = DB00598

| ChemSpiderID_Ref =  DaY | ChemSpiderID = 3734 | UNII_Ref =  DaY | UNII = R5H8897N95 | KEGG_Ref =  DaY | KEGG = D08106 | ChEBI_Ref =  DaY | ChEBI = 6343 | ChEMBL_Ref =  DaY | ChEMBL = 429

| C=19 | H=24 | N=2 | O=3 | molecular_weight = 328,406 g/mol | smiles = O=C(c1cc(ccc1O)C(O)CNC(C)CCc2ccccc2)N | InChI = 1/C19H24N2O3/c1-13(7-8-14-5-3-2-4-6-14)21-12-18(23)15-9-10-17(22)16(11-15)19(20)24/h2-6,9-11,13,18,21-23H,7-8,12H2,1H3,(H2,20,24) | InChIKey = SGUAFYQXFOLMHL-UHFFFAOYAT | StdInChI_Ref =  DaY | StdInChI = 1S/C19H24N2O3/c1-13(7-8-14-5-3-2-4-6-14)21-12-18(23)15-9-10-17(22)16(11-15)19(20)24/h2-6,9-11,13,18,21-23H,7-8,12H2,1H3,(H2,20,24) | StdInChIKey_Ref =  DaY | StdInChIKey = SGUAFYQXFOLMHL-UHFFFAOYSA-N }} Labetalol (Normodin, Trandat) je mešoviti alfa/beta adrenergički antagonist, koji se koristi za tretiranje visokog krvnog pritiska.[1]

Indikcije[uredi | uredi kod]

Koristi se kao tretman trudnoćom indukovanu hipertenziju koja je često vezana za preeklampsiju.[2] On se takođe koristi za tretiranje hronične i akutne hipertenzije feohromocitoma i hipertenzivne krize.[3][4]

Stereokemija[uredi | uredi kod]

Labetalol sadrži dva stereogena centra i sastoji se od četiri stereoizomera. Ovo je mješavina ("R", "R") -, ("S", "R") -, ("R", "S" ) - i ( S , S ) - oblik:

Stereoizomeri Labetalola

CAS-Nummer: 75659-07-3

CAS-Nummer: 83167-24-2

CAS-Nummer: 83167-32-2

CAS-Nummer: 83167-31-1

Reference[uredi | uredi kod]

  1. Fahed S, Grum DF, Papadimos TJ (2008). „Labetalol infusion for refractory hypertension causing severe hypotension and bradycardia: an issue of patient safety”. Patient Saf Surg 2: 13. DOI:10.1186/1754-9493-2-13. PMC 2429901. PMID 18505576. 
  2. C. J. Pickles, E. M. Symonds, F. Broughton Pipkin (January 1989). „The fetal outcome in a randomized double-blind controlled trial of labetalol versus placebo in pregnancy-induced hypertension”. BJOG: An International Journal of Obstetrics & Gynaecology 96 (1): 38–43. DOI:10.1111/j.1471-0528.1989.tb01574.x. 
  3. Katzung, Bertram G. (2006). Basic and clinical pharmacology. New York: McGraw-Hill Medical. str. 170. ISBN 0-07-145153-6. 
  4. D A Richards, J Tuckman, and B N Prichard (October 1976). „Assessment of alpha- and beta-adrenoceptor blocking actions of labetalol”. Br J Clin Pharmacol 3 (5): 849–855. PMC 1428931. PMID 9968. 

Literatura[uredi | uredi kod]

Spoljašnje veze[uredi | uredi kod]